C39H37N3O6S — CID 22193459
N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22193459) has the molecular formula C39H37N3O6S and a molecular weight of 675.81 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22193459 |
| Molecular Formula | C39H37N3O6S |
| Molecular Weight | 675.81 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | N-[(Z)-3-oxo-3-[4-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SCC(=O)n2c3c(c4ccccc42)CCCC3)cc1 |
| InChI | InChI=1S/C39H37N3O6S/c1-46-34-23-36(48-3)35(47-2)22-26(34)21-31(41-38(44)25-11-5-4-6-12-25)39(45)40-27-17-19-28(20-18-27)49-24-37(43)42-32-15-9-7-13-29(32)30-14-8-10-16-33(30)42/h4-7,9,11-13,15,17-23H,8,10,14,16,24H2,1-3H3,(H,40,45)(H,41,44)/b31-21- |
| InChIKey | RGXKSKFUUKIEKK-YQYKVWLJSA-N |
| XLogP | 7.39 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.81 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|