C36H30ClN3O3S — CID 19301775
N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19301775) has the molecular formula C36H30ClN3O3S and a molecular weight of 620.17 g/mol. Its IUPAC name is N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301775 |
| Molecular Formula | C36H30ClN3O3S |
| Molecular Weight | 620.17 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | N-[(Z)-1-(2-chlorophenyl)-3-oxo-3-[3-[2-oxo-2-(1,2,3,4-tetrahydrocarbazol-9-yl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)n2c3c(c4ccccc42)CCCC3)c1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H30ClN3O3S/c37-30-18-7-4-13-25(30)21-31(39-35(42)24-11-2-1-3-12-24)36(43)38-26-14-10-15-27(22-26)44-23-34(41)40-32-19-8-5-16-28(32)29-17-6-9-20-33(29)40/h1-5,7-8,10-16,18-19,21-22H,6,9,17,20,23H2,(H,38,43)(H,39,42)/b31-21- |
| InChIKey | MGNAPRXCFBCJTM-YQYKVWLJSA-N |
| XLogP | 8.02 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.17 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|