C31H24ClN3O5S — CID 19305450
N-[(E)-3-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19305450) has the molecular formula C31H24ClN3O5S and a molecular weight of 586.07 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19305450 |
| Molecular Formula | C31H24ClN3O5S |
| Molecular Weight | 586.07 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | N-[(E)-3-[3-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-chlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2ccccc2Cl)NC(=O)c2ccccc2)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H24ClN3O5S/c32-25-12-5-4-9-21(25)15-26(35-30(37)20-7-2-1-3-8-20)31(38)34-22-10-6-11-24(16-22)41-18-29(36)33-23-13-14-27-28(17-23)40-19-39-27/h1-17H,18-19H2,(H,33,36)(H,34,38)(H,35,37)/b26-15+ |
| InChIKey | VJVPRJXJISSINW-CVKSISIWSA-N |
| XLogP | 6.21 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.07 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|