C33H28ClN3O5S — CID 19305410
ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 19305410) has the molecular formula C33H28ClN3O5S and a molecular weight of 614.12 g/mol. Its IUPAC name is ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19305410 |
| Molecular Formula | C33H28ClN3O5S |
| Molecular Weight | 614.12 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | ethyl 4-[[2-[3-[[(E)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccccc3Cl)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H28ClN3O5S/c1-2-42-33(41)23-15-17-25(18-16-23)35-30(38)21-43-27-13-8-12-26(20-27)36-32(40)29(19-24-11-6-7-14-28(24)34)37-31(39)22-9-4-3-5-10-22/h3-20H,2,21H2,1H3,(H,35,38)(H,36,40)(H,37,39)/b29-19+ |
| InChIKey | WNLMVBJIBJXIOM-VUTHCHCSSA-N |
| XLogP | 6.66 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.12 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|