C35H32ClN3O5S — CID 19306024
butyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 19306024) has the molecular formula C35H32ClN3O5S and a molecular weight of 642.18 g/mol. Its IUPAC name is butyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19306024 |
| Molecular Formula | C35H32ClN3O5S |
| Molecular Weight | 642.18 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | butyl 4-[[2-[3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2cccc(NC(=O)/C(=C/c3ccc(Cl)cc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C35H32ClN3O5S/c1-2-3-20-44-35(43)26-14-18-28(19-15-26)37-32(40)23-45-30-11-7-10-29(22-30)38-34(42)31(21-24-12-16-27(36)17-13-24)39-33(41)25-8-5-4-6-9-25/h4-19,21-22H,2-3,20,23H2,1H3,(H,37,40)(H,38,42)(H,39,41)/b31-21- |
| InChIKey | BTLQUGVBUYHJCN-YQYKVWLJSA-N |
| XLogP | 7.44 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.18 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|