C37H37N3O7S — CID 21385525
butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 21385525) has the molecular formula C37H37N3O7S and a molecular weight of 667.78 g/mol. Its IUPAC name is butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 21385525 |
| Molecular Formula | C37H37N3O7S |
| Molecular Weight | 667.78 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)/C(=C/c3cccc(OC)c3OC)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H37N3O7S/c1-4-5-22-47-37(44)26-14-16-28(17-15-26)38-33(41)24-48-30-20-18-29(19-21-30)39-36(43)31(40-35(42)25-10-7-6-8-11-25)23-27-12-9-13-32(45-2)34(27)46-3/h6-21,23H,4-5,22,24H2,1-3H3,(H,38,41)(H,39,43)(H,40,42)/b31-23- |
| InChIKey | METZFYSRUZATIE-SXBRIOAWSA-N |
| XLogP | 6.80 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.78 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|