C32H28N4O5S — CID 22186748
4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide (PubChem CID 22186748) has the molecular formula C32H28N4O5S and a molecular weight of 580.67 g/mol. Its IUPAC name is 4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 22186748 |
| Molecular Formula | C32H28N4O5S |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzamide |
| SMILES | COc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SCC(=O)Nc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C32H28N4O5S/c1-41-28-10-6-5-9-23(28)19-27(36-31(39)22-7-3-2-4-8-22)32(40)35-25-15-17-26(18-16-25)42-20-29(37)34-24-13-11-21(12-14-24)30(33)38/h2-19H,20H2,1H3,(H2,33,38)(H,34,37)(H,35,40)(H,36,39)/b27-19- |
| InChIKey | QEDUPOVFFNAMDO-DIBXZPPDSA-N |
| XLogP | 4.93 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|