C38H39N3O7S — CID 21385455
butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 21385455) has the molecular formula C38H39N3O7S and a molecular weight of 681.81 g/mol. Its IUPAC name is butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 21385455 |
| Molecular Formula | C38H39N3O7S |
| Molecular Weight | 681.81 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | butyl 4-[2-[4-[[(Z)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3cccc(OC)c3OC)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H39N3O7S/c1-5-6-23-48-38(45)27-15-17-29(18-16-27)39-35(42)25(2)49-31-21-19-30(20-22-31)40-37(44)32(41-36(43)26-11-8-7-9-12-26)24-28-13-10-14-33(46-3)34(28)47-4/h7-22,24-25H,5-6,23H2,1-4H3,(H,39,42)(H,40,44)(H,41,43)/b32-24- |
| InChIKey | JNIZUJRSQYRSLO-TZHWMEPESA-N |
| XLogP | 7.19 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.81 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|