C36H37N3O5S — CID 22186667
N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22186667) has the molecular formula C36H37N3O5S and a molecular weight of 623.78 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22186667 |
| Molecular Formula | C36H37N3O5S |
| Molecular Weight | 623.78 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3ccccc3OC)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H37N3O5S/c1-4-5-23-44-30-19-15-28(16-20-30)37-34(40)25(2)45-31-21-17-29(18-22-31)38-36(42)32(24-27-13-9-10-14-33(27)43-3)39-35(41)26-11-7-6-8-12-26/h6-22,24-25H,4-5,23H2,1-3H3,(H,37,40)(H,38,42)(H,39,41)/b32-24- |
| InChIKey | LMFGWTBRWJWXRI-TZHWMEPESA-N |
| XLogP | 7.40 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.78 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|