C35H33N3O6S — CID 22186645
ethyl 4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 22186645) has the molecular formula C35H33N3O6S and a molecular weight of 623.73 g/mol. Its IUPAC name is ethyl 4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 22186645 |
| Molecular Formula | C35H33N3O6S |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | ethyl 4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3ccccc3OC)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C35H33N3O6S/c1-4-44-35(42)25-14-16-27(17-15-25)36-32(39)23(2)45-29-20-18-28(19-21-29)37-34(41)30(22-26-12-8-9-13-31(26)43-3)38-33(40)24-10-6-5-7-11-24/h5-23H,4H2,1-3H3,(H,36,39)(H,37,41)(H,38,40)/b30-22- |
| InChIKey | ZHODVVFXJGGDAY-SWKFRHMKSA-N |
| XLogP | 6.40 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|