C33H29N3O6S — CID 22186670
4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 22186670) has the molecular formula C33H29N3O6S and a molecular weight of 595.68 g/mol. Its IUPAC name is 4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 22186670 |
| Molecular Formula | C33H29N3O6S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | 4-[2-[4-[[(Z)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | COc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(SC(C)C(=O)Nc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H29N3O6S/c1-21(30(37)34-25-14-12-23(13-15-25)33(40)41)43-27-18-16-26(17-19-27)35-32(39)28(20-24-10-6-7-11-29(24)42-2)36-31(38)22-8-4-3-5-9-22/h3-21H,1-2H3,(H,34,37)(H,35,39)(H,36,38)(H,40,41)/b28-20- |
| InChIKey | NBILKPKFZLHECH-RRAHZORUSA-N |
| XLogP | 5.92 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|