C35H35N3O4S — CID 19304784
N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 19304784) has the molecular formula C35H35N3O4S and a molecular weight of 593.75 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19304784 |
| Molecular Formula | C35H35N3O4S |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | N-[(Z)-3-[3-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C/c3ccccc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C35H35N3O4S/c1-3-4-22-42-30-20-18-28(19-21-30)36-33(39)25(2)43-31-17-11-16-29(24-31)37-35(41)32(23-26-12-7-5-8-13-26)38-34(40)27-14-9-6-10-15-27/h5-21,23-25H,3-4,22H2,1-2H3,(H,36,39)(H,37,41)(H,38,40)/b32-23- |
| InChIKey | NRCMQFHLNVILGL-SJIPCVTESA-N |
| XLogP | 7.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|