C39H43N3O7S — CID 19314432
N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314432) has the molecular formula C39H43N3O7S and a molecular weight of 697.85 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314432 |
| Molecular Formula | C39H43N3O7S |
| Molecular Weight | 697.85 g/mol |
| Exact Mass | 697.28 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3cc(OC)c(OC)c(OC)c3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C39H43N3O7S/c1-6-8-21-49-30-19-17-28(18-20-30)40-39(45)35(7-2)50-31-16-12-15-29(25-31)41-38(44)32(42-37(43)27-13-10-9-11-14-27)22-26-23-33(46-3)36(48-5)34(24-26)47-4/h9-20,22-25,35H,6-8,21H2,1-5H3,(H,40,45)(H,41,44)(H,42,43)/b32-22+ |
| InChIKey | KWRJQLUOWIJNSC-WEMUVCOSSA-N |
| XLogP | 7.81 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.85 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|