C36H34ClN3O8S — CID 19314434
3-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid (PubChem CID 19314434) has the molecular formula C36H34ClN3O8S and a molecular weight of 704.20 g/mol. Its IUPAC name is 3-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid.
| Compound Name | 3-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 19314434 |
| Molecular Formula | C36H34ClN3O8S |
| Molecular Weight | 704.20 g/mol |
| Exact Mass | 703.18 |
| IUPAC Name | 3-[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-chlorobenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)c(OC)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C36H34ClN3O8S/c1-5-31(35(43)39-27-19-23(36(44)45)14-15-26(27)37)49-25-13-9-12-24(20-25)38-34(42)28(40-33(41)22-10-7-6-8-11-22)16-21-17-29(46-2)32(48-4)30(18-21)47-3/h6-20,31H,5H2,1-4H3,(H,38,42)(H,39,43)(H,40,41)(H,44,45)/b28-16+ |
| InChIKey | XGEKFOKUDMQZJX-LQKURTRISA-N |
| XLogP | 6.98 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.20 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|