C40H43N3O8S — CID 19314160
butyl 4-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate (PubChem CID 19314160) has the molecular formula C40H43N3O8S and a molecular weight of 725.86 g/mol. Its IUPAC name is butyl 4-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate.
| Compound Name | butyl 4-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate |
|---|---|
| PubChem CID | 19314160 |
| Molecular Formula | C40H43N3O8S |
| Molecular Weight | 725.86 g/mol |
| Exact Mass | 725.28 |
| IUPAC Name | butyl 4-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3cc(OC)c(OC)cc3OC)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C40H43N3O8S/c1-6-8-21-51-40(47)27-17-19-29(20-18-27)41-39(46)36(7-2)52-31-16-12-15-30(24-31)42-38(45)32(43-37(44)26-13-10-9-11-14-26)22-28-23-34(49-4)35(50-5)25-33(28)48-3/h9-20,22-25,36H,6-8,21H2,1-5H3,(H,41,46)(H,42,45)(H,43,44)/b32-22+ |
| InChIKey | SIHMALBWGILTOV-WEMUVCOSSA-N |
| XLogP | 7.59 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.86 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|