C39H41N3O6S — CID 19309840
butyl 4-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate (PubChem CID 19309840) has the molecular formula C39H41N3O6S and a molecular weight of 679.84 g/mol. Its IUPAC name is butyl 4-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate.
| Compound Name | butyl 4-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate |
|---|---|
| PubChem CID | 19309840 |
| Molecular Formula | C39H41N3O6S |
| Molecular Weight | 679.84 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | butyl 4-[2-[3-[[(E)-2-benzamido-3-(2-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3ccccc3OCC)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C39H41N3O6S/c1-4-7-24-48-39(46)28-20-22-30(23-21-28)40-38(45)35(5-2)49-32-18-13-17-31(26-32)41-37(44)33(42-36(43)27-14-9-8-10-15-27)25-29-16-11-12-19-34(29)47-6-3/h8-23,25-26,35H,4-7,24H2,1-3H3,(H,40,45)(H,41,44)(H,42,43)/b33-25+ |
| InChIKey | MYDZZVHMYQEKGR-INKHBPHZSA-N |
| XLogP | 7.96 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.84 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|