C35H35N3O5S — CID 19309812
N-[(E)-1-(2-ethoxyphenyl)-3-[3-[1-(3-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19309812) has the molecular formula C35H35N3O5S and a molecular weight of 609.75 g/mol. Its IUPAC name is N-[(E)-1-(2-ethoxyphenyl)-3-[3-[1-(3-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2-ethoxyphenyl)-3-[3-[1-(3-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19309812 |
| Molecular Formula | C35H35N3O5S |
| Molecular Weight | 609.75 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | N-[(E)-1-(2-ethoxyphenyl)-3-[3-[1-(3-methoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1cccc(SC(CC)C(=O)Nc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C35H35N3O5S/c1-4-32(35(41)37-26-16-11-18-28(22-26)42-3)44-29-19-12-17-27(23-29)36-34(40)30(38-33(39)24-13-7-6-8-14-24)21-25-15-9-10-20-31(25)43-5-2/h6-23,32H,4-5H2,1-3H3,(H,36,40)(H,37,41)(H,38,39)/b30-21+ |
| InChIKey | SJTUOBVTPRFLCM-MWAVMZGNSA-N |
| XLogP | 7.01 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.75 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|