C36H37N3O5S — CID 19307776
N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307776) has the molecular formula C36H37N3O5S and a molecular weight of 623.78 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307776 |
| Molecular Formula | C36H37N3O5S |
| Molecular Weight | 623.78 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | N-[(E)-1-(2,4-dimethoxyphenyl)-3-[3-[1-(3,4-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OC)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C36H37N3O5S/c1-6-33(36(42)38-28-17-15-23(2)24(3)19-28)45-30-14-10-13-27(21-30)37-35(41)31(39-34(40)25-11-8-7-9-12-25)20-26-16-18-29(43-4)22-32(26)44-5/h7-22,33H,6H2,1-5H3,(H,37,41)(H,38,42)(H,39,40)/b31-20+ |
| InChIKey | LUVZLDGGPOLYQZ-AJBULDERSA-N |
| XLogP | 7.24 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|