C40H37N3O6S — CID 19308095
N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-(4-phenoxyanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19308095) has the molecular formula C40H37N3O6S and a molecular weight of 687.82 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-(4-phenoxyanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-(4-phenoxyanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308095 |
| Molecular Formula | C40H37N3O6S |
| Molecular Weight | 687.82 g/mol |
| Exact Mass | 687.24 |
| IUPAC Name | N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[1-oxo-1-(4-phenoxyanilino)butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)ccc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C40H37N3O6S/c1-4-37(40(46)41-29-18-20-32(21-19-29)49-31-15-9-6-10-16-31)50-34-17-11-14-30(26-34)42-39(45)35(43-38(44)27-12-7-5-8-13-27)25-28-24-33(47-2)22-23-36(28)48-3/h5-26,37H,4H2,1-3H3,(H,41,46)(H,42,45)(H,43,44)/b35-25+ |
| InChIKey | OQWOQQOWGGFTRO-KVQDIILNSA-N |
| XLogP | 8.42 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.82 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|