C38H42N4O4S — CID 19308672
N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308672) has the molecular formula C38H42N4O4S and a molecular weight of 650.85 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308672 |
| Molecular Formula | C38H42N4O4S |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-butoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-[4-(dimethylamino)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3ccc(N(C)C)cc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C38H42N4O4S/c1-5-7-24-46-32-22-18-29(19-23-32)39-38(45)35(6-2)47-33-15-11-14-30(26-33)40-37(44)34(41-36(43)28-12-9-8-10-13-28)25-27-16-20-31(21-17-27)42(3)4/h8-23,25-26,35H,5-7,24H2,1-4H3,(H,39,45)(H,40,44)(H,41,43)/b34-25+ |
| InChIKey | OSPCVXJZZJRYMS-YQCHCMBFSA-N |
| XLogP | 7.85 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|