C34H33N5O5S — CID 19308642
N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[1-(4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19308642) has the molecular formula C34H33N5O5S and a molecular weight of 623.74 g/mol. Its IUPAC name is N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[1-(4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[1-(4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308642 |
| Molecular Formula | C34H33N5O5S |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | N-[(E)-1-[4-(dimethylamino)phenyl]-3-[3-[1-(4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(N(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H33N5O5S/c1-4-31(34(42)35-25-15-19-28(20-16-25)39(43)44)45-29-12-8-11-26(22-29)36-33(41)30(37-32(40)24-9-6-5-7-10-24)21-23-13-17-27(18-14-23)38(2)3/h5-22,31H,4H2,1-3H3,(H,35,42)(H,36,41)(H,37,40)/b30-21+ |
| InChIKey | DGFWHWVKYDAHOC-MWAVMZGNSA-N |
| XLogP | 6.58 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|