C34H32N4O6S — CID 19311838
N-[(E)-3-[3-[1-(4-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19311838) has the molecular formula C34H32N4O6S and a molecular weight of 624.72 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311838 |
| Molecular Formula | C34H32N4O6S |
| Molecular Weight | 624.72 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-ethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C34H32N4O6S/c1-3-31(34(41)35-25-15-19-28(20-16-25)44-4-2)45-29-12-8-11-26(22-29)36-33(40)30(37-32(39)24-9-6-5-7-10-24)21-23-13-17-27(18-14-23)38(42)43/h5-22,31H,3-4H2,1-2H3,(H,35,41)(H,36,40)(H,37,39)/b30-21+ |
| InChIKey | GDTQKBYCTCDHFW-MWAVMZGNSA-N |
| XLogP | 6.91 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|