C40H36N4O6S — CID 19314716
N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314716) has the molecular formula C40H36N4O6S and a molecular weight of 700.82 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314716 |
| Molecular Formula | C40H36N4O6S |
| Molecular Weight | 700.82 g/mol |
| Exact Mass | 700.24 |
| IUPAC Name | N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C40H36N4O6S/c1-3-37(40(47)42-35-25-32(44(48)49)20-17-27(35)2)51-34-16-10-15-31(24-34)41-39(46)36(43-38(45)30-13-8-5-9-14-30)23-28-18-21-33(22-19-28)50-26-29-11-6-4-7-12-29/h4-25,37H,3,26H2,1-2H3,(H,41,46)(H,42,47)(H,43,45)/b36-23+ |
| InChIKey | GLGPTHDTJUKWCG-GOJREDGKSA-N |
| XLogP | 8.40 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.82 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|