C34H32N4O7S — CID 19315580
N-[(E)-1-(4-hydroxy-2-methoxyphenyl)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19315580) has the molecular formula C34H32N4O7S and a molecular weight of 640.72 g/mol. Its IUPAC name is N-[(E)-1-(4-hydroxy-2-methoxyphenyl)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(4-hydroxy-2-methoxyphenyl)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19315580 |
| Molecular Formula | C34H32N4O7S |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | N-[(E)-1-(4-hydroxy-2-methoxyphenyl)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(O)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C34H32N4O7S/c1-4-31(34(42)36-28-19-25(38(43)44)15-13-21(28)2)46-27-12-8-11-24(18-27)35-33(41)29(37-32(40)22-9-6-5-7-10-22)17-23-14-16-26(39)20-30(23)45-3/h5-20,31,39H,4H2,1-3H3,(H,35,41)(H,36,42)(H,37,40)/b29-17+ |
| InChIKey | IWVOWMNMVYBIAS-STBIYBPSSA-N |
| XLogP | 6.54 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|