C36H36N4O8S — CID 19314139
N-[(E)-3-[3-[1-(2-methyl-4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314139) has the molecular formula C36H36N4O8S and a molecular weight of 684.77 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(2-methyl-4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(2-methyl-4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314139 |
| Molecular Formula | C36H36N4O8S |
| Molecular Weight | 684.77 g/mol |
| Exact Mass | 684.23 |
| IUPAC Name | N-[(E)-3-[3-[1-(2-methyl-4-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C36H36N4O8S/c1-6-33(36(43)38-28-16-15-26(40(44)45)17-22(28)2)49-27-14-10-13-25(20-27)37-35(42)29(39-34(41)23-11-8-7-9-12-23)18-24-19-31(47-4)32(48-5)21-30(24)46-3/h7-21,33H,6H2,1-5H3,(H,37,42)(H,38,43)(H,39,41)/b29-18+ |
| InChIKey | PVPBVMWLSIIITB-RDRPBHBLSA-N |
| XLogP | 6.85 |
| TPSA | 158.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.77 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|