C36H36N4O5S — CID 19311260
N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19311260) has the molecular formula C36H36N4O5S and a molecular weight of 636.77 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311260 |
| Molecular Formula | C36H36N4O5S |
| Molecular Weight | 636.77 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | N-[(E)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(C(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C36H36N4O5S/c1-5-33(36(43)38-31-22-29(40(44)45)19-14-24(31)4)46-30-13-9-12-28(21-30)37-35(42)32(39-34(41)27-10-7-6-8-11-27)20-25-15-17-26(18-16-25)23(2)3/h6-23,33H,5H2,1-4H3,(H,37,42)(H,38,43)(H,39,41)/b32-20+ |
| InChIKey | AMKDNWHBDJQFTR-UZWMFBFFSA-N |
| XLogP | 7.95 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.77 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|