C33H30N4O5S — CID 19313708
N-[(Z)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19313708) has the molecular formula C33H30N4O5S and a molecular weight of 594.69 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313708 |
| Molecular Formula | C33H30N4O5S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | N-[(Z)-3-[3-[1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(4-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C)C(=O)Nc3cc([N+](=O)[O-])ccc3C)c2)cc1 |
| InChI | InChI=1S/C33H30N4O5S/c1-21-12-15-24(16-13-21)18-30(36-32(39)25-8-5-4-6-9-25)33(40)34-26-10-7-11-28(19-26)43-23(3)31(38)35-29-20-27(37(41)42)17-14-22(29)2/h4-20,23H,1-3H3,(H,34,40)(H,35,38)(H,36,39)/b30-18- |
| InChIKey | BYPYFPNQCCQUIS-YKQZZPSBSA-N |
| XLogP | 6.74 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|