C37H29FN4O5S — CID 19310756
N-[(Z)-1-(4-fluorophenyl)-3-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19310756) has the molecular formula C37H29FN4O5S and a molecular weight of 660.73 g/mol. Its IUPAC name is N-[(Z)-1-(4-fluorophenyl)-3-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-fluorophenyl)-3-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310756 |
| Molecular Formula | C37H29FN4O5S |
| Molecular Weight | 660.73 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | N-[(Z)-1-(4-fluorophenyl)-3-[3-[2-(2-methyl-5-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(Sc1cccc(NC(=O)/C(=C/c2ccc(F)cc2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C37H29FN4O5S/c1-24-15-20-30(42(46)47)23-32(24)40-37(45)34(26-9-4-2-5-10-26)48-31-14-8-13-29(22-31)39-36(44)33(21-25-16-18-28(38)19-17-25)41-35(43)27-11-6-3-7-12-27/h2-23,34H,1H3,(H,39,44)(H,40,45)(H,41,43)/b33-21- |
| InChIKey | GPOONCCQCOWXTR-HWIUFGAZSA-N |
| XLogP | 7.92 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.73 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|