C35H34ClN3O3S — CID 19311219
N-[(E)-3-[3-[1-(4-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19311219) has the molecular formula C35H34ClN3O3S and a molecular weight of 612.20 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(4-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(4-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311219 |
| Molecular Formula | C35H34ClN3O3S |
| Molecular Weight | 612.20 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | N-[(E)-3-[3-[1-(4-chloroanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-propan-2-ylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(C(C)C)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H34ClN3O3S/c1-4-32(35(42)37-28-19-17-27(36)18-20-28)43-30-12-8-11-29(22-30)38-34(41)31(39-33(40)26-9-6-5-7-10-26)21-24-13-15-25(16-14-24)23(2)3/h5-23,32H,4H2,1-3H3,(H,37,42)(H,38,41)(H,39,40)/b31-21+ |
| InChIKey | WIOWZSHFZTVNAG-NJZRLIGZSA-N |
| XLogP | 8.38 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.20 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|