C34H32ClN3O5S — CID 19306065
N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19306065) has the molecular formula C34H32ClN3O5S and a molecular weight of 630.17 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306065 |
| Molecular Formula | C34H32ClN3O5S |
| Molecular Weight | 630.17 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-[3-[1-(3,5-dimethoxyanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccc(Cl)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C34H32ClN3O5S/c1-4-31(34(41)37-26-18-27(42-2)21-28(19-26)43-3)44-29-12-8-11-25(20-29)36-33(40)30(17-22-13-15-24(35)16-14-22)38-32(39)23-9-6-5-7-10-23/h5-21,31H,4H2,1-3H3,(H,36,40)(H,37,41)(H,38,39)/b30-17- |
| InChIKey | BCLRUOPROUPWCS-LQNQUEJISA-N |
| XLogP | 7.28 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.17 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|