C33H29ClN4O4S — CID 19306092
2-[2-[3-[[(E)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide (PubChem CID 19306092) has the molecular formula C33H29ClN4O4S and a molecular weight of 613.14 g/mol. Its IUPAC name is 2-[2-[3-[[(E)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide.
| Compound Name | 2-[2-[3-[[(E)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide |
|---|---|
| PubChem CID | 19306092 |
| Molecular Formula | C33H29ClN4O4S |
| Molecular Weight | 613.14 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | 2-[2-[3-[[(E)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C33H29ClN4O4S/c1-2-29(33(42)37-27-14-7-6-13-26(27)30(35)39)43-25-12-8-11-24(20-25)36-32(41)28(19-21-15-17-23(34)18-16-21)38-31(40)22-9-4-3-5-10-22/h3-20,29H,2H2,1H3,(H2,35,39)(H,36,41)(H,37,42)(H,38,40)/b28-19+ |
| InChIKey | NYESOCMUJADYEL-TURZUDJPSA-N |
| XLogP | 6.36 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.14 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|