C39H34IN3O4S — CID 19314713
N-[(Z)-3-[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314713) has the molecular formula C39H34IN3O4S and a molecular weight of 767.69 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314713 |
| Molecular Formula | C39H34IN3O4S |
| Molecular Weight | 767.69 g/mol |
| Exact Mass | 767.13 |
| IUPAC Name | N-[(Z)-3-[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C39H34IN3O4S/c1-2-36(39(46)41-31-20-18-30(40)19-21-31)48-34-15-9-14-32(25-34)42-38(45)35(43-37(44)29-12-7-4-8-13-29)24-27-16-22-33(23-17-27)47-26-28-10-5-3-6-11-28/h3-25,36H,2,26H2,1H3,(H,41,46)(H,42,45)(H,43,44)/b35-24- |
| InChIKey | GPSZVGNZFNSLAG-BGDIREAQSA-N |
| XLogP | 8.79 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.69 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|