C34H30N4O7S — CID 19311857
N-[(E)-3-[3-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19311857) has the molecular formula C34H30N4O7S and a molecular weight of 638.70 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311857 |
| Molecular Formula | C34H30N4O7S |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | N-[(E)-3-[3-[1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxobutan-2-yl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc([N+](=O)[O-])cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C34H30N4O7S/c1-2-31(34(41)36-25-13-16-29-30(21-25)45-18-17-44-29)46-27-10-6-9-24(20-27)35-33(40)28(37-32(39)23-7-4-3-5-8-23)19-22-11-14-26(15-12-22)38(42)43/h3-16,19-21,31H,2,17-18H2,1H3,(H,35,40)(H,36,41)(H,37,39)/b28-19+ |
| InChIKey | URLHTSMKWYCXNM-TURZUDJPSA-N |
| XLogP | 6.28 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|