C37H39N3O6S — CID 21385859
N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21385859) has the molecular formula C37H39N3O6S and a molecular weight of 653.80 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385859 |
| Molecular Formula | C37H39N3O6S |
| Molecular Weight | 653.80 g/mol |
| Exact Mass | 653.26 |
| IUPAC Name | N-[(Z)-3-[4-[1-(4-butoxyanilino)-1-oxopropan-2-yl]sulfanylanilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3cc(OC)ccc3OC)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H39N3O6S/c1-5-6-22-46-30-16-12-28(13-17-30)38-35(41)25(2)47-32-19-14-29(15-20-32)39-37(43)33(40-36(42)26-10-8-7-9-11-26)24-27-23-31(44-3)18-21-34(27)45-4/h7-21,23-25H,5-6,22H2,1-4H3,(H,38,41)(H,39,43)(H,40,42)/b33-24- |
| InChIKey | ZQDYLKQDSXPCLB-GIBOGKFOSA-N |
| XLogP | 7.41 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.80 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|