C37H37N3O6S — CID 22186893
butyl 4-[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 22186893) has the molecular formula C37H37N3O6S and a molecular weight of 651.79 g/mol. Its IUPAC name is butyl 4-[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | butyl 4-[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 22186893 |
| Molecular Formula | C37H37N3O6S |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | butyl 4-[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(C)Sc2ccc(NC(=O)/C(=C/c3cccc(OC)c3)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H37N3O6S/c1-4-5-22-46-37(44)28-14-16-29(17-15-28)38-34(41)25(2)47-32-20-18-30(19-21-32)39-36(43)33(24-26-10-9-13-31(23-26)45-3)40-35(42)27-11-7-6-8-12-27/h6-21,23-25H,4-5,22H2,1-3H3,(H,38,41)(H,39,43)(H,40,42)/b33-24- |
| InChIKey | UWDROQQIKAZZHN-GIBOGKFOSA-N |
| XLogP | 7.18 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|