C40H36N4O5S — CID 22189133
butyl 4-[[2-[4-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 22189133) has the molecular formula C40H36N4O5S and a molecular weight of 684.82 g/mol. Its IUPAC name is butyl 4-[[2-[4-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 22189133 |
| Molecular Formula | C40H36N4O5S |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-pyridin-3-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3cccnc3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H36N4O5S/c1-2-3-25-49-40(48)31-16-18-32(19-17-31)43-39(47)36(29-12-6-4-7-13-29)50-34-22-20-33(21-23-34)42-38(46)35(26-28-11-10-24-41-27-28)44-37(45)30-14-8-5-9-15-30/h4-24,26-27,36H,2-3,25H2,1H3,(H,42,46)(H,43,47)(H,44,45)/b35-26- |
| InChIKey | IIVLUQLKMTZYJV-JYUHDHNASA-N |
| XLogP | 7.92 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|