C42H39N3O6S — CID 22187033
butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 22187033) has the molecular formula C42H39N3O6S and a molecular weight of 713.86 g/mol. Its IUPAC name is butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 22187033 |
| Molecular Formula | C42H39N3O6S |
| Molecular Weight | 713.86 g/mol |
| Exact Mass | 713.26 |
| IUPAC Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3cccc(OC)c3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H39N3O6S/c1-3-4-26-51-42(49)32-18-20-33(21-19-32)44-41(48)38(30-13-7-5-8-14-30)52-36-24-22-34(23-25-36)43-40(47)37(28-29-12-11-17-35(27-29)50-2)45-39(46)31-15-9-6-10-16-31/h5-25,27-28,38H,3-4,26H2,1-2H3,(H,43,47)(H,44,48)(H,45,46)/b37-28- |
| InChIKey | FYBAOUDKFLHVIA-FSUXQIQLSA-N |
| XLogP | 8.53 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.86 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|