C38H31N3O7S — CID 22187031
5-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 22187031) has the molecular formula C38H31N3O7S and a molecular weight of 673.75 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 22187031 |
| Molecular Formula | C38H31N3O7S |
| Molecular Weight | 673.75 g/mol |
| Exact Mass | 673.19 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccc(O)c(C(=O)O)c3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C38H31N3O7S/c1-48-29-14-8-9-24(21-29)22-32(41-35(43)26-12-6-3-7-13-26)36(44)39-27-15-18-30(19-16-27)49-34(25-10-4-2-5-11-25)37(45)40-28-17-20-33(42)31(23-28)38(46)47/h2-23,34,42H,1H3,(H,39,44)(H,40,45)(H,41,43)(H,46,47)/b32-22- |
| InChIKey | WINIOMOVRGMDBN-JDCMOKTRSA-N |
| XLogP | 6.98 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|