C37H28ClN3O6S — CID 21384123
5-[[2-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 21384123) has the molecular formula C37H28ClN3O6S and a molecular weight of 678.17 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 21384123 |
| Molecular Formula | C37H28ClN3O6S |
| Molecular Weight | 678.17 g/mol |
| Exact Mass | 677.14 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2-chlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)cc1)/C(=C/c1ccccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H28ClN3O6S/c38-30-14-8-7-13-25(30)21-31(41-34(43)24-11-5-2-6-12-24)35(44)39-26-15-18-28(19-16-26)48-33(23-9-3-1-4-10-23)36(45)40-27-17-20-32(42)29(22-27)37(46)47/h1-22,33,42H,(H,39,44)(H,40,45)(H,41,43)(H,46,47)/b31-21- |
| InChIKey | OYBBQGZGXDSOQW-YQYKVWLJSA-N |
| XLogP | 7.63 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.17 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|