C37H27Cl2N3O6S — CID 21384963
5-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid (PubChem CID 21384963) has the molecular formula C37H27Cl2N3O6S and a molecular weight of 712.61 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 21384963 |
| Molecular Formula | C37H27Cl2N3O6S |
| Molecular Weight | 712.61 g/mol |
| Exact Mass | 711.10 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc(O)c(C(=O)O)c2)c2ccccc2)cc1)/C(=C/c1cccc(Cl)c1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H27Cl2N3O6S/c38-29-13-7-12-24(32(29)39)20-30(42-34(44)23-10-5-2-6-11-23)35(45)40-25-14-17-27(18-15-25)49-33(22-8-3-1-4-9-22)36(46)41-26-16-19-31(43)28(21-26)37(47)48/h1-21,33,43H,(H,40,45)(H,41,46)(H,42,44)(H,47,48)/b30-20- |
| InChIKey | NWAQGRDLMWCYRC-COEJQBHMSA-N |
| XLogP | 8.28 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.61 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|