C40H29Cl2N3O3S — CID 21384930
N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21384930) has the molecular formula C40H29Cl2N3O3S and a molecular weight of 702.66 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21384930 |
| Molecular Formula | C40H29Cl2N3O3S |
| Molecular Weight | 702.66 g/mol |
| Exact Mass | 701.13 |
| IUPAC Name | N-[(Z)-1-(2,3-dichlorophenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SC(C(=O)Nc2ccc3ccccc3c2)c2ccccc2)cc1)/C(=C/c1cccc(Cl)c1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H29Cl2N3O3S/c41-34-17-9-16-30(36(34)42)25-35(45-38(46)28-13-5-2-6-14-28)39(47)43-31-20-22-33(23-21-31)49-37(27-11-3-1-4-12-27)40(48)44-32-19-18-26-10-7-8-15-29(26)24-32/h1-25,37H,(H,43,47)(H,44,48)(H,45,46)/b35-25- |
| InChIKey | OFBVYCBSFBHPAM-CKWSZQMZSA-N |
| XLogP | 10.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.66 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|