C42H35N3O5S — CID 21385560
N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21385560) has the molecular formula C42H35N3O5S and a molecular weight of 693.83 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385560 |
| Molecular Formula | C42H35N3O5S |
| Molecular Weight | 693.83 g/mol |
| Exact Mass | 693.23 |
| IUPAC Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-[4-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccc4ccccc4c3)c3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C42H35N3O5S/c1-49-37-19-11-18-32(38(37)50-2)27-36(45-40(46)30-15-7-4-8-16-30)41(47)43-33-22-24-35(25-23-33)51-39(29-13-5-3-6-14-29)42(48)44-34-21-20-28-12-9-10-17-31(28)26-34/h3-27,39H,1-2H3,(H,43,47)(H,44,48)(H,45,46)/b36-27- |
| InChIKey | XVIKSJWFJMUHSB-RLANJUCJSA-N |
| XLogP | 8.74 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.83 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|