C37H32N4O5S — CID 19713942
N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19713942) has the molecular formula C37H32N4O5S and a molecular weight of 644.75 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19713942 |
| Molecular Formula | C37H32N4O5S |
| Molecular Weight | 644.75 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccccn3)c3ccccc3)cc2)c1OC |
| InChI | InChI=1S/C37H32N4O5S/c1-45-31-17-11-16-27(33(31)46-2)24-30(40-35(42)26-14-7-4-8-15-26)36(43)39-28-19-21-29(22-20-28)47-34(25-12-5-3-6-13-25)37(44)41-32-18-9-10-23-38-32/h3-24,34H,1-2H3,(H,39,43)(H,40,42)(H,38,41,44)/b30-24- |
| InChIKey | FKXMRZNUJDKUIN-KRUMMXJUSA-N |
| XLogP | 6.98 |
| TPSA | 118.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|