C40H35N3O6S — CID 19307571
N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307571) has the molecular formula C40H35N3O6S and a molecular weight of 685.80 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307571 |
| Molecular Formula | C40H35N3O6S |
| Molecular Weight | 685.80 g/mol |
| Exact Mass | 685.22 |
| IUPAC Name | N-[(E)-3-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccc(C(C)=O)cc3)c3ccccc3)c2)c1OC |
| InChI | InChI=1S/C40H35N3O6S/c1-26(44)27-20-22-31(23-21-27)41-40(47)37(28-12-6-4-7-13-28)50-33-18-11-17-32(25-33)42-39(46)34(43-38(45)29-14-8-5-9-15-29)24-30-16-10-19-35(48-2)36(30)49-3/h4-25,37H,1-3H3,(H,41,47)(H,42,46)(H,43,45)/b34-24+ |
| InChIKey | HWJQUWCXONSTBF-JGRMKTMXSA-N |
| XLogP | 7.79 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.80 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|