C46H35N3O7S — CID 19319589
N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19319589) has the molecular formula C46H35N3O7S and a molecular weight of 773.87 g/mol. Its IUPAC name is N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19319589 |
| Molecular Formula | C46H35N3O7S |
| Molecular Weight | 773.87 g/mol |
| Exact Mass | 773.22 |
| IUPAC Name | N-[(E)-1-(2,3-dimethoxyphenyl)-3-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3cccc4c3C(=O)c3ccccc3C4=O)c3ccccc3)c2)c1OC |
| InChI | InChI=1S/C46H35N3O7S/c1-55-38-25-11-18-30(42(38)56-2)26-37(49-44(52)29-16-7-4-8-17-29)45(53)47-31-19-12-20-32(27-31)57-43(28-14-5-3-6-15-28)46(54)48-36-24-13-23-35-39(36)41(51)34-22-10-9-21-33(34)40(35)50/h3-27,43H,1-2H3,(H,47,53)(H,48,54)(H,49,52)/b37-26+ |
| InChIKey | NYBQHTSGGKWCOO-AVLPFNLUSA-N |
| XLogP | 8.36 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.87 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|