C40H37N3O7S — CID 19314491
N-[(E)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314491) has the molecular formula C40H37N3O7S and a molecular weight of 703.82 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314491 |
| Molecular Formula | C40H37N3O7S |
| Molecular Weight | 703.82 g/mol |
| Exact Mass | 703.24 |
| IUPAC Name | N-[(E)-3-[3-[2-(2-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1NC(=O)C(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)c(OC)c2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C40H37N3O7S/c1-47-33-21-12-11-20-31(33)42-40(46)37(27-14-7-5-8-15-27)51-30-19-13-18-29(25-30)41-39(45)32(43-38(44)28-16-9-6-10-17-28)22-26-23-34(48-2)36(50-4)35(24-26)49-3/h5-25,37H,1-4H3,(H,41,45)(H,42,46)(H,43,44)/b32-22+ |
| InChIKey | RRPXFQOHKOXCSR-WEMUVCOSSA-N |
| XLogP | 7.60 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.82 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|