C39H33Cl2N3O6S — CID 19314467
N-[(E)-3-[3-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314467) has the molecular formula C39H33Cl2N3O6S and a molecular weight of 742.68 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314467 |
| Molecular Formula | C39H33Cl2N3O6S |
| Molecular Weight | 742.68 g/mol |
| Exact Mass | 741.15 |
| IUPAC Name | N-[(E)-3-[3-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccc(Cl)c(Cl)c3)c3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C39H33Cl2N3O6S/c1-48-33-20-24(21-34(49-2)35(33)50-3)19-32(44-37(45)26-13-8-5-9-14-26)38(46)42-27-15-10-16-29(22-27)51-36(25-11-6-4-7-12-25)39(47)43-28-17-18-30(40)31(41)23-28/h4-23,36H,1-3H3,(H,42,46)(H,43,47)(H,44,45)/b32-19+ |
| InChIKey | GJZOEAXFJGYHPW-BIZUNTBRSA-N |
| XLogP | 8.90 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.68 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|