C40H35N3O8S — CID 22190591
3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 22190591) has the molecular formula C40H35N3O8S and a molecular weight of 717.80 g/mol. Its IUPAC name is 3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22190591 |
| Molecular Formula | C40H35N3O8S |
| Molecular Weight | 717.80 g/mol |
| Exact Mass | 717.21 |
| IUPAC Name | 3-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | COc1cc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3cccc(C(=O)O)c3)c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C40H35N3O8S/c1-49-33-22-25(23-34(50-2)35(33)51-3)21-32(43-37(44)27-13-8-5-9-14-27)38(45)41-29-17-19-31(20-18-29)52-36(26-11-6-4-7-12-26)39(46)42-30-16-10-15-28(24-30)40(47)48/h4-24,36H,1-3H3,(H,41,45)(H,42,46)(H,43,44)(H,47,48)/b32-21- |
| InChIKey | PKIHGJVOBAWFRV-QXPFVDMISA-N |
| XLogP | 7.29 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.80 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|