C41H37N3O8S — CID 22190581
methyl 2-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 22190581) has the molecular formula C41H37N3O8S and a molecular weight of 731.83 g/mol. Its IUPAC name is methyl 2-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 22190581 |
| Molecular Formula | C41H37N3O8S |
| Molecular Weight | 731.83 g/mol |
| Exact Mass | 731.23 |
| IUPAC Name | methyl 2-[[2-[4-[[(Z)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(Sc1ccc(NC(=O)/C(=C/c2cc(OC)c(OC)c(OC)c2)NC(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C41H37N3O8S/c1-49-34-24-26(25-35(50-2)36(34)51-3)23-33(44-38(45)28-15-9-6-10-16-28)39(46)42-29-19-21-30(22-20-29)53-37(27-13-7-5-8-14-27)40(47)43-32-18-12-11-17-31(32)41(48)52-4/h5-25,37H,1-4H3,(H,42,46)(H,43,47)(H,44,45)/b33-23- |
| InChIKey | QOLLMNNUAGDPNV-SNCSUOKWSA-N |
| XLogP | 7.38 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.83 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|