C38H32FN3O5S — CID 21386200
N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 21386200) has the molecular formula C38H32FN3O5S and a molecular weight of 661.76 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386200 |
| Molecular Formula | C38H32FN3O5S |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-[4-[2-(2-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3ccccc3F)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C38H32FN3O5S/c1-46-33-22-17-25(24-34(33)47-2)23-32(42-36(43)27-13-7-4-8-14-27)37(44)40-28-18-20-29(21-19-28)48-35(26-11-5-3-6-12-26)38(45)41-31-16-10-9-15-30(31)39/h3-24,35H,1-2H3,(H,40,44)(H,41,45)(H,42,43)/b32-23- |
| InChIKey | XYLWIBMIEPNPEX-SJIPCVTESA-N |
| XLogP | 7.72 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|